C28H22NO+ — CID 5111420
1-(furan-2-ylmethyl)-2,4,6-triphenylpyridin-1-ium (PubChem CID 5111420) has the molecular formula C28H22NO+ and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2,4,6-triphenylpyridin-1-ium.
| Compound Name | 1-(furan-2-ylmethyl)-2,4,6-triphenylpyridin-1-ium |
|---|---|
| PubChem CID | 5111420 |
| Molecular Formula | C28H22NO+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2,4,6-triphenylpyridin-1-ium |
| SMILES | c1ccc(-c2cc(-c3ccccc3)[n+](Cc3ccco3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H22NO/c1-4-11-22(12-5-1)25-19-27(23-13-6-2-7-14-23)29(21-26-17-10-18-30-26)28(20-25)24-15-8-3-9-16-24/h1-20H,21H2/q+1 |
| InChIKey | UXKFIIWHOFQZTK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|