C30H25ClN2O5S — CID 24994606
4-[(2,4,6-triphenylpyridin-1-ium-1-yl)methyl]benzenesulfonamide chlorate (PubChem CID 24994606) has the molecular formula C30H25ClN2O5S and a molecular weight of 561.06 g/mol. Its IUPAC name is 4-[(2,4,6-triphenylpyridin-1-ium-1-yl)methyl]benzenesulfonamide chlorate.
| Compound Name | 4-[(2,4,6-triphenylpyridin-1-ium-1-yl)methyl]benzenesulfonamide chlorate |
|---|---|
| PubChem CID | 24994606 |
| Molecular Formula | C30H25ClN2O5S |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 4-[(2,4,6-triphenylpyridin-1-ium-1-yl)methyl]benzenesulfonamide chlorate |
| SMILES | NS(=O)(=O)c1ccc(C[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1.[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/C30H25N2O2S.ClO3/c31-35(33,34)28-18-16-23(17-19-28)22-32-29(25-12-6-2-7-13-25)20-27(24-10-4-1-5-11-24)21-30(32)26-14-8-3-9-15-26;2-1(3)4/h1-21H,22H2,(H2,31,33,34);/q+1;-1 |
| InChIKey | KDQZVUCGIGTVML-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|