C23H27ClN2O5S — CID 24993673
4-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]benzenesulfonamide chlorate (PubChem CID 24993673) has the molecular formula C23H27ClN2O5S and a molecular weight of 479.00 g/mol. Its IUPAC name is 4-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]benzenesulfonamide chlorate.
| Compound Name | 4-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]benzenesulfonamide chlorate |
|---|---|
| PubChem CID | 24993673 |
| Molecular Formula | C23H27ClN2O5S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 4-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]benzenesulfonamide chlorate |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)[n+]1-c1ccc(S(N)(=O)=O)cc1.[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/C23H27N2O2S.ClO3/c1-16(2)22-14-19(18-8-6-5-7-9-18)15-23(17(3)4)25(22)20-10-12-21(13-11-20)28(24,26)27;2-1(3)4/h5-17H,1-4H3,(H2,24,26,27);/q+1;-1 |
| InChIKey | NIEVQPQJGUVPBS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|