C24H29N4O2S+ — CID 10602464
2-[4-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]phenyl]sulfonylguanidine (PubChem CID 10602464) has the molecular formula C24H29N4O2S+ and a molecular weight of 437.59 g/mol. Its IUPAC name is 2-[4-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]phenyl]sulfonylguanidine.
| Compound Name | 2-[4-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 10602464 |
| Molecular Formula | C24H29N4O2S+ |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-[4-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]phenyl]sulfonylguanidine |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)[n+]1-c1ccc(S(=O)(=O)N=C(N)N)cc1 |
| InChI | InChI=1S/C24H29N4O2S/c1-16(2)22-14-19(18-8-6-5-7-9-18)15-23(17(3)4)28(22)20-10-12-21(13-11-20)31(29,30)27-24(25)26/h5-17H,1-4H3,(H4,25,26,27)/q+1 |
| InChIKey | UHKNNXLWYRRRRA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|