C28H29ClN4O6S — CID 10650956
2-[4-(2-butyl-4,6-diphenylpyridin-1-ium-1-yl)phenyl]sulfonylguanidine perchlorate (PubChem CID 10650956) has the molecular formula C28H29ClN4O6S and a molecular weight of 585.08 g/mol. Its IUPAC name is 2-[4-(2-butyl-4,6-diphenylpyridin-1-ium-1-yl)phenyl]sulfonylguanidine perchlorate.
| Compound Name | 2-[4-(2-butyl-4,6-diphenylpyridin-1-ium-1-yl)phenyl]sulfonylguanidine perchlorate |
|---|---|
| PubChem CID | 10650956 |
| Molecular Formula | C28H29ClN4O6S |
| Molecular Weight | 585.08 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 2-[4-(2-butyl-4,6-diphenylpyridin-1-ium-1-yl)phenyl]sulfonylguanidine perchlorate |
| SMILES | CCCCc1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1-c1ccc(S(=O)(=O)N=C(N)N)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C28H29N4O2S.ClHO4/c1-2-3-14-25-19-23(21-10-6-4-7-11-21)20-27(22-12-8-5-9-13-22)32(25)24-15-17-26(18-16-24)35(33,34)31-28(29)30;2-1(3,4)5/h4-13,15-20H,2-3,14H2,1H3,(H4,29,30,31);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | CNQZRTGFXCRHNM-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 194.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.08 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|