C38H30NO2+ — CID 3799304
2-phenylethyl 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoate (PubChem CID 3799304) has the molecular formula C38H30NO2+ and a molecular weight of 532.66 g/mol. Its IUPAC name is 2-phenylethyl 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoate.
| Compound Name | 2-phenylethyl 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoate |
|---|---|
| PubChem CID | 3799304 |
| Molecular Formula | C38H30NO2+ |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-phenylethyl 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoate |
| SMILES | O=C(OCCc1ccccc1)c1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H30NO2/c40-38(41-26-25-29-13-5-1-6-14-29)33-21-23-35(24-22-33)39-36(31-17-9-3-10-18-31)27-34(30-15-7-2-8-16-30)28-37(39)32-19-11-4-12-20-32/h1-24,27-28H,25-26H2/q+1 |
| InChIKey | WHPZAKRNCMARSA-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|