C25H20ClNO7 — CID 10504949
2-hydroxy-4-(2-methyl-4,6-diphenylpyridin-1-ium-1-yl)benzoic acid perchlorate (PubChem CID 10504949) has the molecular formula C25H20ClNO7 and a molecular weight of 481.89 g/mol. Its IUPAC name is 2-hydroxy-4-(2-methyl-4,6-diphenylpyridin-1-ium-1-yl)benzoic acid perchlorate.
| Compound Name | 2-hydroxy-4-(2-methyl-4,6-diphenylpyridin-1-ium-1-yl)benzoic acid perchlorate |
|---|---|
| PubChem CID | 10504949 |
| Molecular Formula | C25H20ClNO7 |
| Molecular Weight | 481.89 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-hydroxy-4-(2-methyl-4,6-diphenylpyridin-1-ium-1-yl)benzoic acid perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1-c1ccc(C(=O)O)c(O)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H19NO3.ClHO4/c1-17-14-20(18-8-4-2-5-9-18)15-23(19-10-6-3-7-11-19)26(17)21-12-13-22(25(28)29)24(27)16-21;2-1(3,4)5/h2-16H,1H3,(H-,27,28,29);(H,2,3,4,5) |
| InChIKey | BTFBDPYRFXLNIS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.89 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|