C29H20Cl2NO+ — CID 156757104
2-chloro-4-[2-(4-chlorophenyl)-4,6-diphenylpyridin-1-ium-1-yl]phenol (PubChem CID 156757104) has the molecular formula C29H20Cl2NO+ and a molecular weight of 469.39 g/mol. Its IUPAC name is 2-chloro-4-[2-(4-chlorophenyl)-4,6-diphenylpyridin-1-ium-1-yl]phenol.
| Compound Name | 2-chloro-4-[2-(4-chlorophenyl)-4,6-diphenylpyridin-1-ium-1-yl]phenol |
|---|---|
| PubChem CID | 156757104 |
| Molecular Formula | C29H20Cl2NO+ |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-chloro-4-[2-(4-chlorophenyl)-4,6-diphenylpyridin-1-ium-1-yl]phenol |
| SMILES | Oc1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C29H19Cl2NO/c30-24-13-11-22(12-14-24)28-18-23(20-7-3-1-4-8-20)17-27(21-9-5-2-6-10-21)32(28)25-15-16-29(33)26(31)19-25/h1-19H/p+1 |
| InChIKey | UPKOCZWFWUIWKY-UHFFFAOYSA-O |
| XLogP | 7.98 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|