C29H19Cl2NO — CID 135121618
2,5-dichloro-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate (PubChem CID 135121618) has the molecular formula C29H19Cl2NO and a molecular weight of 468.38 g/mol. Its IUPAC name is 2,5-dichloro-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate.
| Compound Name | 2,5-dichloro-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate |
|---|---|
| PubChem CID | 135121618 |
| Molecular Formula | C29H19Cl2NO |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 2,5-dichloro-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate |
| SMILES | [O-]c1cc(Cl)c(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C29H19Cl2NO/c30-24-19-29(33)25(31)18-28(24)32-26(21-12-6-2-7-13-21)16-23(20-10-4-1-5-11-20)17-27(32)22-14-8-3-9-15-22/h1-19H |
| InChIKey | PEDJJAYQSNQGIF-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|