C33H23NO — CID 142748322
5-(2,4,6-triphenylpyridin-1-ium-1-yl)naphthalen-1-olate (PubChem CID 142748322) has the molecular formula C33H23NO and a molecular weight of 449.55 g/mol. Its IUPAC name is 5-(2,4,6-triphenylpyridin-1-ium-1-yl)naphthalen-1-olate.
| Compound Name | 5-(2,4,6-triphenylpyridin-1-ium-1-yl)naphthalen-1-olate |
|---|---|
| PubChem CID | 142748322 |
| Molecular Formula | C33H23NO |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 5-(2,4,6-triphenylpyridin-1-ium-1-yl)naphthalen-1-olate |
| SMILES | [O-]c1cccc2c(-[n+]3c(-c4ccccc4)cc(-c4ccccc4)cc3-c3ccccc3)cccc12 |
| InChI | InChI=1S/C33H23NO/c35-33-21-11-18-28-29(33)19-10-20-30(28)34-31(25-14-6-2-7-15-25)22-27(24-12-4-1-5-13-24)23-32(34)26-16-8-3-9-17-26/h1-23H |
| InChIKey | WZIINEDKIQAKLN-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|