C27H21N2S+ — CID 3337384
3-methyl-5-(2,4,6-triphenylpyridin-1-ium-1-yl)-1,2-thiazole (PubChem CID 3337384) has the molecular formula C27H21N2S+ and a molecular weight of 405.55 g/mol. Its IUPAC name is 3-methyl-5-(2,4,6-triphenylpyridin-1-ium-1-yl)-1,2-thiazole.
| Compound Name | 3-methyl-5-(2,4,6-triphenylpyridin-1-ium-1-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 3337384 |
| Molecular Formula | C27H21N2S+ |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-methyl-5-(2,4,6-triphenylpyridin-1-ium-1-yl)-1,2-thiazole |
| SMILES | Cc1cc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)sn1 |
| InChI | InChI=1S/C27H21N2S/c1-20-17-27(30-28-20)29-25(22-13-7-3-8-14-22)18-24(21-11-5-2-6-12-21)19-26(29)23-15-9-4-10-16-23/h2-19H,1H3/q+1 |
| InChIKey | XFSMZZYMLZOGGM-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|