C29H22NO4Re — CID 21324133
oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium (PubChem CID 21324133) has the molecular formula C29H22NO4Re and a molecular weight of 634.71 g/mol. Its IUPAC name is oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium.
| Compound Name | oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium |
|---|---|
| PubChem CID | 21324133 |
| Molecular Formula | C29H22NO4Re |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 635.11 |
| IUPAC Name | oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium |
| SMILES | O=[Re](=O)(=O)[O-].c1ccc(-c2cc(-c3ccccc3)[n+](-c3ccccc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H22N.4O.Re/c1-5-13-23(14-6-1)26-21-28(24-15-7-2-8-16-24)30(27-19-11-4-12-20-27)29(22-26)25-17-9-3-10-18-25;;;;;/h1-22H;;;;;/q+1;;;;-1; |
| InChIKey | FAXDEXTUCFSPQI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|