About oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium
oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium (PubChem CID 21324133) has the molecular formula C29H22NO4Re
and a molecular weight of 634.71 g/mol. Its IUPAC name is oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium.
Molecular Properties
| Compound Name | oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium |
| PubChem CID | 21324133 |
| Molecular Formula | C29H22NO4Re |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 635.11 |
| IUPAC Name | oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium |
| SMILES | O=[Re](=O)(=O)[O-].c1ccc(-c2cc(-c3ccccc3)[n+](-c3ccccc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H22N.4O.Re/c1-5-13-23(14-6-1)26-21-28(24-15-7-2-8-16-24)30(27-19-11-4-12-20-27)29(22-26)25-17-9-3-10-18-25;;;;;/h1-22H;;;;;/q+1;;;;-1; |
| InChIKey | FAXDEXTUCFSPQI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium?
The IUPAC name of oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium (CID 21324133) is oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium.
What is the SMILES notation for oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium?
The canonical SMILES for oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium is O=[Re](=O)(=O)[O-].c1ccc(-c2cc(-c3ccccc3)[n+](-c3ccccc3)c(-c3ccccc3)c2)cc1.
What is the InChIKey of oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium?
The InChIKey is FAXDEXTUCFSPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22N.4O.Re/c1-5-13-23(14-6-1)26-21-28(24-15-7-2-8-16-24)30(27-19-11-4-12-20-27)29(22-26)25-17-9-3-10-18-25;;;;;/h1-22H;;;;;/q+1;;;;-1;.
What are the key properties of oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium?
oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium has a molecular weight of 634.71 g/mol, XLogP of 5.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxido(trioxo)rhenium;1,2,4,6-tetraphenylpyridin-1-ium is sourced from PubChem (CID 21324133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).