C36H29NO4S — CID 11146226
4-methylbenzenesulfonate;4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenol (PubChem CID 11146226) has the molecular formula C36H29NO4S and a molecular weight of 571.70 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenol.
| Compound Name | 4-methylbenzenesulfonate;4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenol |
|---|---|
| PubChem CID | 11146226 |
| Molecular Formula | C36H29NO4S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 4-methylbenzenesulfonate;4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenol |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Oc1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21NO.C7H8O3S/c31-27-18-16-26(17-19-27)30-28(23-12-6-2-7-13-23)20-25(22-10-4-1-5-11-22)21-29(30)24-14-8-3-9-15-24;1-6-2-4-7(5-3-6)11(8,9)10/h1-21H;2-5H,1H3,(H,8,9,10) |
| InChIKey | NTBASRKZCXPGBU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|