C29H22ClNO5 — CID 12647559
3-(2,4,6-triphenylpyridin-1-ium-1-yl)phenol perchlorate (PubChem CID 12647559) has the molecular formula C29H22ClNO5 and a molecular weight of 499.95 g/mol. Its IUPAC name is 3-(2,4,6-triphenylpyridin-1-ium-1-yl)phenol perchlorate.
| Compound Name | 3-(2,4,6-triphenylpyridin-1-ium-1-yl)phenol perchlorate |
|---|---|
| PubChem CID | 12647559 |
| Molecular Formula | C29H22ClNO5 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3-(2,4,6-triphenylpyridin-1-ium-1-yl)phenol perchlorate |
| SMILES | Oc1cccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H21NO.ClHO4/c31-27-18-10-17-26(21-27)30-28(23-13-6-2-7-14-23)19-25(22-11-4-1-5-12-22)20-29(30)24-15-8-3-9-16-24;2-1(3,4)5/h1-21H;(H,2,3,4,5) |
| InChIKey | DBBXWTCKDMQAQH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|