C29H20ClNO — CID 142748320
2-chloro-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate (PubChem CID 142748320) has the molecular formula C29H20ClNO and a molecular weight of 433.94 g/mol. Its IUPAC name is 2-chloro-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate.
| Compound Name | 2-chloro-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate |
|---|---|
| PubChem CID | 142748320 |
| Molecular Formula | C29H20ClNO |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-chloro-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate |
| SMILES | [O-]c1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C29H20ClNO/c30-26-20-25(16-17-29(26)32)31-27(22-12-6-2-7-13-22)18-24(21-10-4-1-5-11-21)19-28(31)23-14-8-3-9-15-23/h1-20H |
| InChIKey | QJDYYVCADCHYBS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|