C27H22Cl2N+ — CID 3723114
1-(3,4-dichlorophenyl)-2,4-diphenyl-5,6,7,8-tetrahydroquinolin-1-ium (PubChem CID 3723114) has the molecular formula C27H22Cl2N+ and a molecular weight of 431.39 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2,4-diphenyl-5,6,7,8-tetrahydroquinolin-1-ium.
| Compound Name | 1-(3,4-dichlorophenyl)-2,4-diphenyl-5,6,7,8-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 3723114 |
| Molecular Formula | C27H22Cl2N+ |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2,4-diphenyl-5,6,7,8-tetrahydroquinolin-1-ium |
| SMILES | Clc1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)c3c2CCCC3)cc1Cl |
| InChI | InChI=1S/C27H22Cl2N/c28-24-16-15-21(17-25(24)29)30-26-14-8-7-13-22(26)23(19-9-3-1-4-10-19)18-27(30)20-11-5-2-6-12-20/h1-6,9-12,15-18H,7-8,13-14H2/q+1 |
| InChIKey | HOESPWCBLFUMGN-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|