C30H27ClINS2 — CID 13114984
8-[bis(methylsulfanyl)methylidene]-1-(4-chlorophenyl)-2,4-diphenyl-6,7-dihydro-5H-quinolin-1-ium iodide (PubChem CID 13114984) has the molecular formula C30H27ClINS2 and a molecular weight of 628.04 g/mol. Its IUPAC name is 8-[bis(methylsulfanyl)methylidene]-1-(4-chlorophenyl)-2,4-diphenyl-6,7-dihydro-5H-quinolin-1-ium iodide.
| Compound Name | 8-[bis(methylsulfanyl)methylidene]-1-(4-chlorophenyl)-2,4-diphenyl-6,7-dihydro-5H-quinolin-1-ium iodide |
|---|---|
| PubChem CID | 13114984 |
| Molecular Formula | C30H27ClINS2 |
| Molecular Weight | 628.04 g/mol |
| Exact Mass | 627.03 |
| IUPAC Name | 8-[bis(methylsulfanyl)methylidene]-1-(4-chlorophenyl)-2,4-diphenyl-6,7-dihydro-5H-quinolin-1-ium iodide |
| SMILES | CSC(SC)=C1CCCc2c(-c3ccccc3)cc(-c3ccccc3)[n+](-c3ccc(Cl)cc3)c21.[I-] |
| InChI | InChI=1S/C30H27ClNS2.HI/c1-33-30(34-2)26-15-9-14-25-27(21-10-5-3-6-11-21)20-28(22-12-7-4-8-13-22)32(29(25)26)24-18-16-23(31)17-19-24;/h3-8,10-13,16-20H,9,14-15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OVCKYFOTMFGWCJ-UHFFFAOYSA-M |
| XLogP | 5.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.04 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|