C31H24BClF4N2O — CID 13114910
1-(4-chlorophenyl)-N-(4-methylphenyl)-4,6-diphenylpyridin-1-ium-2-carboxamide tetrafluoroborate (PubChem CID 13114910) has the molecular formula C31H24BClF4N2O and a molecular weight of 562.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(4-methylphenyl)-4,6-diphenylpyridin-1-ium-2-carboxamide tetrafluoroborate.
| Compound Name | 1-(4-chlorophenyl)-N-(4-methylphenyl)-4,6-diphenylpyridin-1-ium-2-carboxamide tetrafluoroborate |
|---|---|
| PubChem CID | 13114910 |
| Molecular Formula | C31H24BClF4N2O |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(4-methylphenyl)-4,6-diphenylpyridin-1-ium-2-carboxamide tetrafluoroborate |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3ccccc3)cc(-c3ccccc3)[n+]2-c2ccc(Cl)cc2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C31H23ClN2O.BF4/c1-22-12-16-27(17-13-22)33-31(35)30-21-25(23-8-4-2-5-9-23)20-29(24-10-6-3-7-11-24)34(30)28-18-14-26(32)15-19-28;2-1(3,4)5/h2-21H,1H3;/q;-1/p+1 |
| InChIKey | AXGRNNYKFJHRJP-UHFFFAOYSA-O |
| XLogP | 8.81 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|