C30H22NO2+ — CID 3720319
4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoic acid (PubChem CID 3720319) has the molecular formula C30H22NO2+ and a molecular weight of 428.51 g/mol. Its IUPAC name is 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoic acid.
| Compound Name | 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoic acid |
|---|---|
| PubChem CID | 3720319 |
| Molecular Formula | C30H22NO2+ |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-(2,4,6-triphenylpyridin-1-ium-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H21NO2/c32-30(33)25-16-18-27(19-17-25)31-28(23-12-6-2-7-13-23)20-26(22-10-4-1-5-11-22)21-29(31)24-14-8-3-9-15-24/h1-21H/p+1 |
| InChIKey | RWIXLXQLXKUAIK-UHFFFAOYSA-O |
| XLogP | 6.66 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|