C32H24ClNOS — CID 4221561
8-[(4-chlorophenoxy)-thiophen-2-ylmethylidene]-2,4-diphenyl-6,7-dihydro-5H-quinoline (PubChem CID 4221561) has the molecular formula C32H24ClNOS and a molecular weight of 506.07 g/mol. Its IUPAC name is 8-[(4-chlorophenoxy)-thiophen-2-ylmethylidene]-2,4-diphenyl-6,7-dihydro-5H-quinoline.
| Compound Name | 8-[(4-chlorophenoxy)-thiophen-2-ylmethylidene]-2,4-diphenyl-6,7-dihydro-5H-quinoline |
|---|---|
| PubChem CID | 4221561 |
| Molecular Formula | C32H24ClNOS |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 8-[(4-chlorophenoxy)-thiophen-2-ylmethylidene]-2,4-diphenyl-6,7-dihydro-5H-quinoline |
| SMILES | Clc1ccc(OC(=C2CCCc3c(-c4ccccc4)cc(-c4ccccc4)nc32)c2cccs2)cc1 |
| InChI | InChI=1S/C32H24ClNOS/c33-24-16-18-25(19-17-24)35-32(30-15-8-20-36-30)27-14-7-13-26-28(22-9-3-1-4-10-22)21-29(34-31(26)27)23-11-5-2-6-12-23/h1-6,8-12,15-21H,7,13-14H2 |
| InChIKey | ADEPNSKCXWQZJR-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|