C14H12ClN — CID 118037090
4-chloro-2-phenyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 118037090) has the molecular formula C14H12ClN and a molecular weight of 229.71 g/mol. Its IUPAC name is 4-chloro-2-phenyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | 4-chloro-2-phenyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 118037090 |
| Molecular Formula | C14H12ClN |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-chloro-2-phenyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | Clc1cc(-c2ccccc2)nc2c1CCC2 |
| InChI | InChI=1S/C14H12ClN/c15-12-9-14(10-5-2-1-3-6-10)16-13-8-4-7-11(12)13/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | PGPGDKWVFGXIPP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |