C18H14ClN — CID 63408824
9-chloro-5-phenyl-2,3-dihydro-1H-cyclopenta[b]quinoline (PubChem CID 63408824) has the molecular formula C18H14ClN and a molecular weight of 279.77 g/mol. Its IUPAC name is 9-chloro-5-phenyl-2,3-dihydro-1H-cyclopenta[b]quinoline.
| Compound Name | 9-chloro-5-phenyl-2,3-dihydro-1H-cyclopenta[b]quinoline |
|---|---|
| PubChem CID | 63408824 |
| Molecular Formula | C18H14ClN |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 9-chloro-5-phenyl-2,3-dihydro-1H-cyclopenta[b]quinoline |
| SMILES | Clc1c2c(nc3c(-c4ccccc4)cccc13)CCC2 |
| InChI | InChI=1S/C18H14ClN/c19-17-14-9-5-11-16(14)20-18-13(8-4-10-15(17)18)12-6-2-1-3-7-12/h1-4,6-8,10H,5,9,11H2 |
| InChIKey | ZUKNPIACDHAILT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |