C13H11BrClN — CID 63408990
5-bromo-9-chloro-1,2,3,4-tetrahydroacridine (PubChem CID 63408990) has the molecular formula C13H11BrClN and a molecular weight of 296.59 g/mol. Its IUPAC name is 5-bromo-9-chloro-1,2,3,4-tetrahydroacridine.
| Compound Name | 5-bromo-9-chloro-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 63408990 |
| Molecular Formula | C13H11BrClN |
| Molecular Weight | 296.59 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 5-bromo-9-chloro-1,2,3,4-tetrahydroacridine |
| SMILES | Clc1c2c(nc3c(Br)cccc13)CCCC2 |
| InChI | InChI=1S/C13H11BrClN/c14-10-6-3-5-9-12(15)8-4-1-2-7-11(8)16-13(9)10/h3,5-6H,1-2,4,7H2 |
| InChIKey | PWOGHUXURPDQNE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |