About 2,4-dibromoquinoline
2,4-dibromoquinoline (PubChem CID 824608) has the molecular formula C9H5Br2N
and a molecular weight of 286.95 g/mol. Its IUPAC name is 2,4-dibromoquinoline.
Molecular Properties
| Compound Name | 2,4-dibromoquinoline |
| PubChem CID | 824608 |
| Molecular Formula | C9H5Br2N |
| Molecular Weight | 286.95 g/mol |
| Exact Mass | 284.88 |
| IUPAC Name | 2,4-dibromoquinoline |
| SMILES | Brc1cc(Br)c2ccccc2n1 |
| InChI | InChI=1S/C9H5Br2N/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5H |
| InChIKey | CYRONKIISXPXER-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromoquinoline?
The IUPAC name of 2,4-dibromoquinoline (CID 824608) is 2,4-dibromoquinoline.
What is the SMILES notation for 2,4-dibromoquinoline?
The canonical SMILES for 2,4-dibromoquinoline is Brc1cc(Br)c2ccccc2n1.
What is the InChIKey of 2,4-dibromoquinoline?
The InChIKey is CYRONKIISXPXER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2N/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5H.
What are the key properties of 2,4-dibromoquinoline?
2,4-dibromoquinoline has a molecular weight of 286.95 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromoquinoline is sourced from PubChem (CID 824608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).