C14H9Br2N — CID 46187619
2,4-dibromo-9-methylacridine (PubChem CID 46187619) has the molecular formula C14H9Br2N and a molecular weight of 351.04 g/mol. Its IUPAC name is 2,4-dibromo-9-methylacridine.
| Compound Name | 2,4-dibromo-9-methylacridine |
|---|---|
| PubChem CID | 46187619 |
| Molecular Formula | C14H9Br2N |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.91 |
| IUPAC Name | 2,4-dibromo-9-methylacridine |
| SMILES | Cc1c2ccccc2nc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C14H9Br2N/c1-8-10-4-2-3-5-13(10)17-14-11(8)6-9(15)7-12(14)16/h2-7H,1H3 |
| InChIKey | FDGOLBPOAHISOM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|