C15H14ClN — CID 15020616
2-chloro-4-phenyl-5,6,7,8-tetrahydroquinoline (PubChem CID 15020616) has the molecular formula C15H14ClN and a molecular weight of 243.74 g/mol. Its IUPAC name is 2-chloro-4-phenyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-chloro-4-phenyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 15020616 |
| Molecular Formula | C15H14ClN |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-chloro-4-phenyl-5,6,7,8-tetrahydroquinoline |
| SMILES | Clc1cc(-c2ccccc2)c2c(n1)CCCC2 |
| InChI | InChI=1S/C15H14ClN/c16-15-10-13(11-6-2-1-3-7-11)12-8-4-5-9-14(12)17-15/h1-3,6-7,10H,4-5,8-9H2 |
| InChIKey | HPOIKUGIRMPSJB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|