C19H18N2 — CID 19804321
6-phenyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 19804321) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-phenyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 6-phenyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 19804321 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 6-phenyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Nc1c2c(nc3cc(-c4ccccc4)ccc13)CCCC2 |
| InChI | InChI=1S/C19H18N2/c20-19-15-8-4-5-9-17(15)21-18-12-14(10-11-16(18)19)13-6-2-1-3-7-13/h1-3,6-7,10-12H,4-5,8-9H2,(H2,20,21) |
| InChIKey | LBHADESMXQAJSE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |