C19H18N2O3 — CID 6611504
2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;2-hydroxybenzoic acid (PubChem CID 6611504) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;2-hydroxybenzoic acid.
| Compound Name | 2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 6611504 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;2-hydroxybenzoic acid |
| SMILES | Nc1c2c(nc3ccccc13)CCC2.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C12H12N2.C7H6O3/c13-12-8-4-1-2-6-10(8)14-11-7-3-5-9(11)12;8-6-4-2-1-3-5(6)7(9)10/h1-2,4,6H,3,5,7H2,(H2,13,14);1-4,8H,(H,9,10) |
| InChIKey | OTPBEGYPBAVYQD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |