C16H22IN2- — CID 159322065
methyliodanuidylethane;1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 159322065) has the molecular formula C16H22IN2- and a molecular weight of 369.27 g/mol. Its IUPAC name is methyliodanuidylethane;1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | methyliodanuidylethane;1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 159322065 |
| Molecular Formula | C16H22IN2- |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | methyliodanuidylethane;1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CC[I-]C.Nc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C13H14N2.C3H8I/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-3-4-2/h1,3,5,7H,2,4,6,8H2,(H2,14,15);3H2,1-2H3/q;-1 |
| InChIKey | HRPGONWOXRONOC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|