C14H17ClN2 — CID 164616381
6-methyl-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride (PubChem CID 164616381) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 6-methyl-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride.
| Compound Name | 6-methyl-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride |
|---|---|
| PubChem CID | 164616381 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-methyl-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride |
| SMILES | Cc1ccc2c(N)c3c(nc2c1)CCCC3.Cl |
| InChI | InChI=1S/C14H16N2.ClH/c1-9-6-7-11-13(8-9)16-12-5-3-2-4-10(12)14(11)15;/h6-8H,2-5H2,1H3,(H2,15,16);1H |
| InChIKey | ZPIHOLUTDWJMGA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |