About acridin-9-amine;λ2-plumbane
acridin-9-amine;λ2-plumbane (PubChem CID 173496858) has the molecular formula C13H12N2Pb
and a molecular weight of 403.45 g/mol. Its IUPAC name is acridin-9-amine;λ2-plumbane.
Molecular Properties
| Compound Name | acridin-9-amine;λ2-plumbane |
| PubChem CID | 173496858 |
| Molecular Formula | C13H12N2Pb |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | acridin-9-amine;λ2-plumbane |
| SMILES | Nc1c2ccccc2nc2ccccc12.[PbH2] |
| InChI | InChI=1S/C13H10N2.Pb.2H/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;;;/h1-8H,(H2,14,15);;; |
| InChIKey | UMROWDUJKFRTSF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridin-9-amine;λ2-plumbane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridin-9-amine;λ2-plumbane?
The IUPAC name of acridin-9-amine;λ2-plumbane (CID 173496858) is acridin-9-amine;λ2-plumbane.
What is the SMILES notation for acridin-9-amine;λ2-plumbane?
The canonical SMILES for acridin-9-amine;λ2-plumbane is Nc1c2ccccc2nc2ccccc12.[PbH2].
What is the InChIKey of acridin-9-amine;λ2-plumbane?
The InChIKey is UMROWDUJKFRTSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2.Pb.2H/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;;;/h1-8H,(H2,14,15);;;.
What are the key properties of acridin-9-amine;λ2-plumbane?
acridin-9-amine;λ2-plumbane has a molecular weight of 403.45 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acridin-9-amine;λ2-plumbane is sourced from PubChem (CID 173496858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).