C23H25N3 — CID 175429789
(3S)-1-(7-phenyl-1,2,3,4-tetrahydroacridin-9-yl)pyrrolidin-3-amine (PubChem CID 175429789) has the molecular formula C23H25N3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (3S)-1-(7-phenyl-1,2,3,4-tetrahydroacridin-9-yl)pyrrolidin-3-amine.
| Compound Name | (3S)-1-(7-phenyl-1,2,3,4-tetrahydroacridin-9-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 175429789 |
| Molecular Formula | C23H25N3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (3S)-1-(7-phenyl-1,2,3,4-tetrahydroacridin-9-yl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CCN(c2c3c(nc4ccc(-c5ccccc5)cc24)CCCC3)C1 |
| InChI | InChI=1S/C23H25N3/c24-18-12-13-26(15-18)23-19-8-4-5-9-21(19)25-22-11-10-17(14-20(22)23)16-6-2-1-3-7-16/h1-3,6-7,10-11,14,18H,4-5,8-9,12-13,15,24H2/t18-/m0/s1 |
| InChIKey | JDQKFEPRCUFBRZ-SFHVURJKSA-N |
| XLogP | 4.32 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |