C22H24N4 — CID 175776998
1-(7-pyridin-3-yl-1,2,3,4-tetrahydroacridin-9-yl)pyrrolidin-3-amine (PubChem CID 175776998) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(7-pyridin-3-yl-1,2,3,4-tetrahydroacridin-9-yl)pyrrolidin-3-amine.
| Compound Name | 1-(7-pyridin-3-yl-1,2,3,4-tetrahydroacridin-9-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 175776998 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-(7-pyridin-3-yl-1,2,3,4-tetrahydroacridin-9-yl)pyrrolidin-3-amine |
| SMILES | NC1CCN(c2c3c(nc4ccc(-c5cccnc5)cc24)CCCC3)C1 |
| InChI | InChI=1S/C22H24N4/c23-17-9-11-26(14-17)22-18-5-1-2-6-20(18)25-21-8-7-15(12-19(21)22)16-4-3-10-24-13-16/h3-4,7-8,10,12-13,17H,1-2,5-6,9,11,14,23H2 |
| InChIKey | YGGVOQBCUQOIKJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |