C15H15ClN2O — CID 118205484
2-chloro-4-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline (PubChem CID 118205484) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 2-chloro-4-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-chloro-4-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 118205484 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-chloro-4-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline |
| SMILES | Clc1cc(OCc2ccccn2)c2c(n1)CCCC2 |
| InChI | InChI=1S/C15H15ClN2O/c16-15-9-14(12-6-1-2-7-13(12)18-15)19-10-11-5-3-4-8-17-11/h3-5,8-9H,1-2,6-7,10H2 |
| InChIKey | YYQLLGABKOGFAS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|