C16H18N2O2 — CID 156783281
2-methoxy-4-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline (PubChem CID 156783281) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-methoxy-4-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-methoxy-4-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 156783281 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-methoxy-4-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline |
| SMILES | COc1cc(OCc2ccccn2)c2c(n1)CCCC2 |
| InChI | InChI=1S/C16H18N2O2/c1-19-16-10-15(13-7-2-3-8-14(13)18-16)20-11-12-6-4-5-9-17-12/h4-6,9-10H,2-3,7-8,11H2,1H3 |
| InChIKey | DIOYQQRQNFFYNI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |