C21H20FN3O — CID 118205297
4-(2-fluoro-5-methyl-3-pyridinyl)-2-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline (PubChem CID 118205297) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-(2-fluoro-5-methyl-3-pyridinyl)-2-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 4-(2-fluoro-5-methyl-3-pyridinyl)-2-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 118205297 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-(2-fluoro-5-methyl-3-pyridinyl)-2-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline |
| SMILES | Cc1cnc(F)c(-c2cc(OCc3ccccn3)nc3c2CCCC3)c1 |
| InChI | InChI=1S/C21H20FN3O/c1-14-10-18(21(22)24-12-14)17-11-20(25-19-8-3-2-7-16(17)19)26-13-15-6-4-5-9-23-15/h4-6,9-12H,2-3,7-8,13H2,1H3 |
| InChIKey | LGZHZRXJRDBOSG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|