About 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline
2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline (PubChem CID 71522060) has the molecular formula C22H16N2S
and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline.
Molecular Properties
| Compound Name | 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline |
| PubChem CID | 71522060 |
| Molecular Formula | C22H16N2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline |
| SMILES | c1ccc(-c2cc(-c3cccnc3)c3c(n2)-c2ccsc2CC3)cc1 |
| InChI | InChI=1S/C22H16N2S/c1-2-5-15(6-3-1)20-13-19(16-7-4-11-23-14-16)17-8-9-21-18(10-12-25-21)22(17)24-20/h1-7,10-14H,8-9H2 |
| InChIKey | MAHNXTHVCQXSKY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline?
The IUPAC name of 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline (CID 71522060) is 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline.
What is the SMILES notation for 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline?
The canonical SMILES for 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline is c1ccc(-c2cc(-c3cccnc3)c3c(n2)-c2ccsc2CC3)cc1.
What is the InChIKey of 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline?
The InChIKey is MAHNXTHVCQXSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2S/c1-2-5-15(6-3-1)20-13-19(16-7-4-11-23-14-16)17-8-9-21-18(10-12-25-21)22(17)24-20/h1-7,10-14H,8-9H2.
What are the key properties of 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline?
2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline has a molecular weight of 340.45 g/mol, XLogP of 5.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4-pyridin-3-yl-5,6-dihydrothieno[2,3-h]quinoline is sourced from PubChem (CID 71522060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).