C23H16N2O — CID 53375672
2-phenyl-4-pyridin-3-yl-5H-chromeno[4,3-b]pyridine (PubChem CID 53375672) has the molecular formula C23H16N2O and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-phenyl-4-pyridin-3-yl-5H-chromeno[4,3-b]pyridine.
| Compound Name | 2-phenyl-4-pyridin-3-yl-5H-chromeno[4,3-b]pyridine |
|---|---|
| PubChem CID | 53375672 |
| Molecular Formula | C23H16N2O |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-phenyl-4-pyridin-3-yl-5H-chromeno[4,3-b]pyridine |
| SMILES | c1ccc(-c2cc(-c3cccnc3)c3c(n2)-c2ccccc2OC3)cc1 |
| InChI | InChI=1S/C23H16N2O/c1-2-7-16(8-3-1)21-13-19(17-9-6-12-24-14-17)20-15-26-22-11-5-4-10-18(22)23(20)25-21/h1-14H,15H2 |
| InChIKey | PGROBUYDXYRAHH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |