C20H13NO3 — CID 53361435
2,4-bis(furan-2-yl)-5H-chromeno[4,3-b]pyridine (PubChem CID 53361435) has the molecular formula C20H13NO3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2,4-bis(furan-2-yl)-5H-chromeno[4,3-b]pyridine.
| Compound Name | 2,4-bis(furan-2-yl)-5H-chromeno[4,3-b]pyridine |
|---|---|
| PubChem CID | 53361435 |
| Molecular Formula | C20H13NO3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2,4-bis(furan-2-yl)-5H-chromeno[4,3-b]pyridine |
| SMILES | c1coc(-c2cc(-c3ccco3)c3c(n2)-c2ccccc2OC3)c1 |
| InChI | InChI=1S/C20H13NO3/c1-2-6-17-13(5-1)20-15(12-24-17)14(18-7-3-9-22-18)11-16(21-20)19-8-4-10-23-19/h1-11H,12H2 |
| InChIKey | VWOFTAMNVDDOSM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 48.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |