C21H14N2OS — CID 53377303
2-pyridin-2-yl-4-thiophen-2-yl-5H-chromeno[4,3-b]pyridine (PubChem CID 53377303) has the molecular formula C21H14N2OS and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-pyridin-2-yl-4-thiophen-2-yl-5H-chromeno[4,3-b]pyridine.
| Compound Name | 2-pyridin-2-yl-4-thiophen-2-yl-5H-chromeno[4,3-b]pyridine |
|---|---|
| PubChem CID | 53377303 |
| Molecular Formula | C21H14N2OS |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-pyridin-2-yl-4-thiophen-2-yl-5H-chromeno[4,3-b]pyridine |
| SMILES | c1ccc(-c2cc(-c3cccs3)c3c(n2)-c2ccccc2OC3)nc1 |
| InChI | InChI=1S/C21H14N2OS/c1-2-8-19-14(6-1)21-16(13-24-19)15(20-9-5-11-25-20)12-18(23-21)17-7-3-4-10-22-17/h1-12H,13H2 |
| InChIKey | OUWAZIDXPNGAHY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |