C24H17NO3 — CID 137133397
3-[2-(4-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol (PubChem CID 137133397) has the molecular formula C24H17NO3 and a molecular weight of 367.40 g/mol. Its IUPAC name is 3-[2-(4-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol.
| Compound Name | 3-[2-(4-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol |
|---|---|
| PubChem CID | 137133397 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[2-(4-hydroxyphenyl)-5H-chromeno[4,3-b]pyridin-4-yl]phenol |
| SMILES | Oc1ccc(-c2cc(-c3cccc(O)c3)c3c(n2)-c2ccccc2OC3)cc1 |
| InChI | InChI=1S/C24H17NO3/c26-17-10-8-15(9-11-17)22-13-20(16-4-3-5-18(27)12-16)21-14-28-23-7-2-1-6-19(23)24(21)25-22/h1-13,26-27H,14H2 |
| InChIKey | PGFVQHMHXXRNLM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |