C24H17NO2 — CID 155533192
2-(4-hydroxyphenyl)-4-phenyl-5H-indeno[1,2-b]pyridin-8-ol (PubChem CID 155533192) has the molecular formula C24H17NO2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-4-phenyl-5H-indeno[1,2-b]pyridin-8-ol.
| Compound Name | 2-(4-hydroxyphenyl)-4-phenyl-5H-indeno[1,2-b]pyridin-8-ol |
|---|---|
| PubChem CID | 155533192 |
| Molecular Formula | C24H17NO2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(4-hydroxyphenyl)-4-phenyl-5H-indeno[1,2-b]pyridin-8-ol |
| SMILES | Oc1ccc(-c2cc(-c3ccccc3)c3c(n2)-c2cc(O)ccc2C3)cc1 |
| InChI | InChI=1S/C24H17NO2/c26-18-9-6-16(7-10-18)23-14-20(15-4-2-1-3-5-15)22-12-17-8-11-19(27)13-21(17)24(22)25-23/h1-11,13-14,26-27H,12H2 |
| InChIKey | OOKLVFLINHXDFN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |