C21H13Cl2N3OS — CID 20896251
N-[4,6-bis(4-chlorophenyl)pyrimidin-2-yl]thiophene-2-carboxamide (PubChem CID 20896251) has the molecular formula C21H13Cl2N3OS and a molecular weight of 426.33 g/mol. Its IUPAC name is N-[4,6-bis(4-chlorophenyl)pyrimidin-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[4,6-bis(4-chlorophenyl)pyrimidin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20896251 |
| Molecular Formula | C21H13Cl2N3OS |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | N-[4,6-bis(4-chlorophenyl)pyrimidin-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)cc2)cc(-c2ccc(Cl)cc2)n1)c1cccs1 |
| InChI | InChI=1S/C21H13Cl2N3OS/c22-15-7-3-13(4-8-15)17-12-18(14-5-9-16(23)10-6-14)25-21(24-17)26-20(27)19-2-1-11-28-19/h1-12H,(H,24,25,26,27) |
| InChIKey | VHYZKFBOPDQWCM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |