C28H25ClN+ — CID 3266272
1-(2-chloropropyl)-2,4-diphenyl-5,6-dihydrobenzo[h]quinolin-1-ium (PubChem CID 3266272) has the molecular formula C28H25ClN+ and a molecular weight of 410.97 g/mol. Its IUPAC name is 1-(2-chloropropyl)-2,4-diphenyl-5,6-dihydrobenzo[h]quinolin-1-ium.
| Compound Name | 1-(2-chloropropyl)-2,4-diphenyl-5,6-dihydrobenzo[h]quinolin-1-ium |
|---|---|
| PubChem CID | 3266272 |
| Molecular Formula | C28H25ClN+ |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-(2-chloropropyl)-2,4-diphenyl-5,6-dihydrobenzo[h]quinolin-1-ium |
| SMILES | CC(Cl)C[n+]1c(-c2ccccc2)cc(-c2ccccc2)c2c1-c1ccccc1CC2 |
| InChI | InChI=1S/C28H25ClN/c1-20(29)19-30-27(23-13-6-3-7-14-23)18-26(21-10-4-2-5-11-21)25-17-16-22-12-8-9-15-24(22)28(25)30/h2-15,18,20H,16-17,19H2,1H3/q+1 |
| InChIKey | HPWHITZHNFUQFM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|