C33H28ClNO8S — CID 44888455
5-(1-benzyl-2-phenyl-5,6-dihydrobenzo[h]quinolin-1-ium-4-yl)-2-methoxybenzenesulfonic acid perchlorate (PubChem CID 44888455) has the molecular formula C33H28ClNO8S and a molecular weight of 634.11 g/mol. Its IUPAC name is 5-(1-benzyl-2-phenyl-5,6-dihydrobenzo[h]quinolin-1-ium-4-yl)-2-methoxybenzenesulfonic acid perchlorate.
| Compound Name | 5-(1-benzyl-2-phenyl-5,6-dihydrobenzo[h]quinolin-1-ium-4-yl)-2-methoxybenzenesulfonic acid perchlorate |
|---|---|
| PubChem CID | 44888455 |
| Molecular Formula | C33H28ClNO8S |
| Molecular Weight | 634.11 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | 5-(1-benzyl-2-phenyl-5,6-dihydrobenzo[h]quinolin-1-ium-4-yl)-2-methoxybenzenesulfonic acid perchlorate |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)[n+](Cc3ccccc3)c3c2CCc2ccccc2-3)cc1S(=O)(=O)O.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C33H27NO4S.ClHO4/c1-38-31-19-17-26(20-32(31)39(35,36)37)29-21-30(25-13-6-3-7-14-25)34(22-23-10-4-2-5-11-23)33-27-15-9-8-12-24(27)16-18-28(29)33;2-1(3,4)5/h2-15,17,19-21H,16,18,22H2,1H3;(H,2,3,4,5) |
| InChIKey | ZPYRHSZVZOWLPF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.11 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|