C28H28NO10S3+ — CID 3489920
5-[1-butyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]-2-methoxybenzenesulfonic acid (PubChem CID 3489920) has the molecular formula C28H28NO10S3+ and a molecular weight of 634.73 g/mol. Its IUPAC name is 5-[1-butyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[1-butyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 3489920 |
| Molecular Formula | C28H28NO10S3+ |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.09 |
| IUPAC Name | 5-[1-butyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]-2-methoxybenzenesulfonic acid |
| SMILES | CCCC[n+]1c(-c2ccc(S(=O)(=O)O)cc2)cc(-c2ccc(OC)c(S(=O)(=O)O)c2)cc1-c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H27NO10S3/c1-3-4-15-29-25(19-5-10-23(11-6-19)40(30,31)32)16-22(21-9-14-27(39-2)28(18-21)42(36,37)38)17-26(29)20-7-12-24(13-8-20)41(33,34)35/h5-14,16-18H,3-4,15H2,1-2H3,(H2-,30,31,32,33,34,35,36,37,38)/p+1 |
| InChIKey | XJGSBCMCKQBEAN-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 176.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|