C20H17NO10S2 — CID 3827486
2,6-bis(4-methoxy-3-sulfophenyl)pyridine-4-carboxylic acid (PubChem CID 3827486) has the molecular formula C20H17NO10S2 and a molecular weight of 495.49 g/mol. Its IUPAC name is 2,6-bis(4-methoxy-3-sulfophenyl)pyridine-4-carboxylic acid.
| Compound Name | 2,6-bis(4-methoxy-3-sulfophenyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 3827486 |
| Molecular Formula | C20H17NO10S2 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 2,6-bis(4-methoxy-3-sulfophenyl)pyridine-4-carboxylic acid |
| SMILES | COc1ccc(-c2cc(C(=O)O)cc(-c3ccc(OC)c(S(=O)(=O)O)c3)n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C20H17NO10S2/c1-30-16-5-3-11(9-18(16)32(24,25)26)14-7-13(20(22)23)8-15(21-14)12-4-6-17(31-2)19(10-12)33(27,28)29/h3-10H,1-2H3,(H,22,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | QCNZCAYWVHETCQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 177.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|