C12H12N2O6S — CID 51056306
3-(4-methoxy-3-sulfophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid (PubChem CID 51056306) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is 3-(4-methoxy-3-sulfophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 3-(4-methoxy-3-sulfophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 51056306 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-(4-methoxy-3-sulfophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2n[nH]c(C)c2C(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C12H12N2O6S/c1-6-10(12(15)16)11(14-13-6)7-3-4-8(20-2)9(5-7)21(17,18)19/h3-5H,1-2H3,(H,13,14)(H,15,16)(H,17,18,19) |
| InChIKey | JQUQPMVXJUREBO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|