C11H9N3O4 — CID 54851348
5-methyl-3-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 54851348) has the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. Its IUPAC name is 5-methyl-3-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-methyl-3-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 54851348 |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-methyl-3-(4-nitrophenyl)-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1[nH]nc(-c2ccc([N+](=O)[O-])cc2)c1C(=O)O |
| InChI | InChI=1S/C11H9N3O4/c1-6-9(11(15)16)10(13-12-6)7-2-4-8(5-3-7)14(17)18/h2-5H,1H3,(H,12,13)(H,15,16) |
| InChIKey | QQQRKZYSVMHYEA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|