C22H16N2O7 — CID 174420639
4-amino-5-benzoyl-6-methyl-2-(4-nitrophenyl)benzene-1,3-dicarboxylic acid (PubChem CID 174420639) has the molecular formula C22H16N2O7 and a molecular weight of 420.38 g/mol. Its IUPAC name is 4-amino-5-benzoyl-6-methyl-2-(4-nitrophenyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-amino-5-benzoyl-6-methyl-2-(4-nitrophenyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174420639 |
| Molecular Formula | C22H16N2O7 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 4-amino-5-benzoyl-6-methyl-2-(4-nitrophenyl)benzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)c2ccccc2)c(N)c(C(=O)O)c(-c2ccc([N+](=O)[O-])cc2)c1C(=O)O |
| InChI | InChI=1S/C22H16N2O7/c1-11-15(21(26)27)17(12-7-9-14(10-8-12)24(30)31)18(22(28)29)19(23)16(11)20(25)13-5-3-2-4-6-13/h2-10H,23H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | YLTWLHRPNFBWTD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|